![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Notice to the student.pdf | 2026-09-18 17:17 | 141K | |
| Notice to the student.docx | 2026-09-18 17:17 | 67K | |
| Mining Engineering_f.pdf | 2026-09-18 17:17 | 58K | |
| Metallurgical and Materials Engineering_f.pdf | 2026-09-18 17:17 | 103K | |
| Mechanical Engineering_f.pdf | 2026-09-18 17:17 | 122K | |
| List of departments.pdf | 2026-09-18 17:17 | 67K | |
| List of departments.docx | 2026-09-18 17:17 | 13K | |
| Information Technology_f.pdf | 2026-09-18 17:17 | 65K | |
| Electronics and Communication Engineering_f.pdf | 2026-09-18 17:17 | 242K | |
| Electrical Engineering_f.pdf | 2026-09-18 17:17 | 132K | |
| Computer_Science and Engineering_f.pdf | 2026-09-18 17:17 | 152K | |
| Civil Engineering_f.pdf | 2026-09-18 17:17 | 164K | |
| Chemical Engineering_f.pdf | 2026-09-18 17:17 | 90K | |
| Biotechnology_f.pdf | 2026-09-18 17:17 | 63K | |
| Biomedical Engineering_f.pdf | 2026-09-18 17:17 | 60K | |
| Applied Geology_f.pdf | 2026-09-18 17:17 | 55K | |