![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Sr. No. 4.docx | 2026-09-18 17:21 | 347K | |
| Sr. No. 3.pdf | 2026-09-18 17:21 | 766K | |
| S.N. 7. Bio Med.pdf | 2026-09-18 17:21 | 3.3M | |
| S.N. 6. Maths.pdf | 2026-09-18 17:21 | 681K | |
| S.N. 5. MME.pdf | 2026-09-18 17:21 | 583K | |
| S.N. 4. Bio Med..pdf | 2026-09-18 17:21 | 766K | |
| S.N. 3. Bio Tech..pdf | 2026-09-18 17:21 | 217K | |
| S.N. 2. MCA.pdf | 2026-09-18 17:21 | 1.3M | |
| S.N. 1. MME.pdf | 2026-09-18 17:21 | 799K | |
| Report on expert lecture_17 oct 25_Mech.pdf | 2026-09-18 17:21 | 1.2M | |
| Report of expert lecture from Prof. Prasad Patnaik BSV BME Department 4th Feb 2026.pdf | 2026-09-18 17:21 | 1.4M | |
| 10. Industry Visit Report_Jayaswal Neco_November 6_th 10 th_2025_MME (1).pdf | 2026-09-18 17:21 | 800K | |
| 9. Deptt of CSE Hosts Expert Talk.pdf | 2026-09-18 17:21 | 1.2M | |
| 08 chemical bet servicing.pdf | 2026-09-18 17:21 | 457K | |